
Catalog Number	AR003NON
Chemical Name	6-(4-Methoxyphenyl)-2-pyridinecarboxaldehyde
CAS Number	502925-47-5
Molecular Formula	C13H11NO2
Molecular Weight	213.2319
MDL Number	MFCD06410025
SMILES	COc1ccc(cc1)c1cccc(n1)C=O

6-(4-Methoxyphenyl)-2-pyridinecarboxaldehyde is a versatile chemical compound widely used in chemical synthesis for various applications. In organic chemistry, it serves as a key building block in the synthesis of pharmaceutical compounds, agrochemicals, and materials science. Its functional groups make it a valuable intermediate for the preparation of complex organic molecules. With its unique structure, this compound plays a crucial role in the creation of diverse chemical derivatives, allowing for a wide range of chemical modifications and transformations. Its importance in the field of chemical synthesis lies in its ability to participate in numerous reactions, such as condensations, additions, and substitutions, to yield structurally diverse products with potential applications in different industries.