
Catalog Number	AR00DL5F
Chemical Name	(3'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid
CAS Number	501944-56-5
Molecular Formula	C13H13BO2
Molecular Weight	212.0521
MDL Number	MFCD08701725
SMILES	Cc1cccc(c1)c1ccc(cc1)B(O)O

The (3'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid is a versatile organic compound that is widely used in chemical synthesis processes. This compound serves as a valuable building block in the formation of various functionalized molecules due to its boronic acid functionality. The boronic acid group in this compound can easily undergo versatile transformations, such as Suzuki-Miyaura cross-coupling reactions, enabling the creation of complex structures with high efficiency. Additionally, the presence of the methyl and biphenyl moieties in the molecule imparts specific steric and electronic properties, further expanding its applicability in synthetic chemistry. Overall, the (3'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid is a crucial reagent in the synthesis of pharmaceuticals, agrochemicals, and materials with tailored properties.