
Catalog Number	AR00E18X
Chemical Name	reumycin
CAS Number	5016-18-2
Molecular Formula	C6H5N5O2
Molecular Weight	179.1362
MDL Number	MFCD00778703
SMILES	Cn1c(=O)[nH]c2c(c1=O)ncnn2

6-Methylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione is a versatile compound used in chemical synthesis as a key building block for the creation of heterocyclic compounds. Its unique structure and reactivity make it an important intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials.In organic synthesis, 6-Methylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione can participate in a range of reactions such as substitution, addition, and cycloaddition reactions. This compound serves as a crucial scaffold for introducing different functional groups and modifying its chemical properties to generate novel molecules with desired biological or physical properties.Due to its electron-rich nature and stability under various reaction conditions, 6-Methylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione is widely utilized in the synthesis of heterocyclic compounds with diverse applications. Its presence in the chemical synthesis toolbox enables the efficient construction of complex molecular structures and contributes to the development of new drugs, pesticides, and advanced materials.