
Catalog Number	AR01KFUR
Chemical Name	2-Fluoro-4-(4-methyl-1-piperazinyl)benzenamine
CAS Number	500205-59-4
Molecular Formula	C11H16FN3
Molecular Weight	209.2632
MDL Number	MFCD16249642
SMILES	NC1=CC=C(N2CCN(C)CC2)C=C1F

2-Fluoro-4-(4-methyl-1-piperazinyl)benzenamine is a versatile compound commonly utilized in chemical synthesis processes. This compound plays a crucial role in organic chemistry as a building block for the creation of various pharmaceuticals, agrochemicals, and materials. Its unique structure makes it highly suitable for introducing specific functional groups or modifications into target molecules during synthesis. Additionally, its fluorine and amine functionalities lend themselves to mediating diverse chemical reactions, enabling the production of a wide range of novel compounds with potential applications in drug discovery and materials science.