
Catalog Number	AR01FLWD
Chemical Name	2-Methyl-4-nitrobenzenethiol
CAS Number	497855-56-8
Molecular Formula	C7H7NO2S
Molecular Weight	169.201
MDL Number	MFCD22481336
SMILES	[O-][N+](=O)c1ccc(c(c1)C)S

2-Methyl-4-nitrobenzenethiol, also known as thiomethylphenidate, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the preparation of various organic molecules due to its unique chemical properties. In particular, 2-Methyl-4-nitrobenzenethiol is commonly employed as a reagent in the synthesis of pharmaceutical intermediates, dyes, and agrochemicals.Its thiol functional group allows for selective reactions with different functional groups, making it a valuable tool in organic chemistry. Furthermore, the nitro group on the aromatic ring provides opportunities for further modifications and derivatization, enabling the creation of diverse chemical structures.In chemical synthesis, 2-Methyl-4-nitrobenzenethiol is often utilized in the formation of C-S bonds through thiol-ene or thiol-alkyne reactions. These reactions play a crucial role in constructing complex organic molecules with specific functional groups. Additionally, the presence of the nitro group can facilitate subsequent reduction steps to access a broad range of derivatives.Overall, 2-Methyl-4-nitrobenzenethiol is a versatile compound with applications in various fields of chemical synthesis, demonstrating its significance as a valuable building block in the creation of diverse organic compounds.