
Catalog Number	AR01E8LA
Chemical Name	Nigerose
CAS Number	497-48-3
Molecular Formula	C12H22O11
Molecular Weight	342.2965
MDL Number	MFCD00057489
SMILES	O=C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O

Nigerose, a rare and valuable sugar derivative, is a key component in various chemical synthesis processes, especially in the field of carbohydrate chemistry. This unique compound offers intricate structural properties that make it a versatile building block for creating complex molecules. Its compatibility with diverse reaction conditions and reagents allows for efficient manipulation in organic synthesis, leading to the development of novel compounds and materials. In particular, Nigerose is often employed in the synthesis of pharmaceuticals, natural products, and specialty chemicals, offering chemists a powerful tool to explore new avenues of molecular design and discovery. Its strategic use in chemical transformations highlights its significance as a pivotal resource in advancing the frontiers of synthetic chemistry.