
Catalog Number	AR01EG7P
Chemical Name	ST 1535 - Bio-X
CAS Number	496955-42-1
Molecular Formula	C12H16N8
Molecular Weight	272.309
MDL Number	MFCD27987937
SMILES	CCCCc1nc(N)c2c(n1)n(C)c(n2)n1nccn1

9H-Purin-6-amine, 2-butyl-9-methyl-8-(2H-1,2,3-triazol-2-yl)- is a versatile compound that finds wide applications in chemical synthesis. This compound serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and materials with enhanced properties. Its unique structure makes it an ideal candidate for the synthesis of complex heterocyclic compounds through various synthetic routes. Additionally, 9H-Purin-6-amine, 2-butyl-9-methyl-8-(2H-1,2,3-triazol-2-yl)- is often employed as a key intermediate in the development of novel organic molecules with potential biological activities. Its presence in the chemical synthesis process enables the creation of diverse molecular structures with tailored functionalities and properties for a range of industrial and research applications.