
Catalog Number	AR003CZD
Chemical Name	(R)-4-((tert-Butoxycarbonyl)amino)-2-hydroxybutanoic acid
CAS Number	496918-28-6
Molecular Formula	C9H17NO5
Molecular Weight	219.2350
MDL Number	MFCD10687136
SMILES	O[C@@H](C(=O)O)CCNC(=O)OC(C)(C)C

The (R)-4-((tert-Butoxycarbonyl)amino)-2-hydroxybutanoic acid holds a crucial role in chemical synthesis, particularly in the realm of peptide synthesis. As a chiral amino acid derivative, it serves as a key building block for the creation of intricate peptide structures with defined stereochemistry. This compound facilitates the controlled synthesis of peptides by enabling the precise incorporation of the (R)-configuration into the peptide backbone.By utilizing (R)-4-((tert-Butoxycarbonyl)amino)-2-hydroxybutanoic acid in chemical reactions, chemists can tailor the properties and functions of peptides for various applications in pharmaceuticals, materials science, and biotechnology. Its strategic placement within peptide sequences imparts specific biological activities, structural stability, and interaction capabilities. This compound's unique chiral and hydroxy functionalities contribute to the diversity and complexity of peptide structures that can be achieved in synthesis.Overall, the application of (R)-4-((tert-Butoxycarbonyl)amino)-2-hydroxybutanoic acid in chemical synthesis empowers researchers to craft novel peptides with tailored properties and functions, driving innovation in diverse fields that rely on peptide-based materials and therapeutics.