
Catalog Number	AR00E07V
Chemical Name	SNICOTINEN1OXIDE
CAS Number	491-26-9
Molecular Formula	C10H14N2O
Molecular Weight	178.231
MDL Number	MFCD00869528
SMILES	[O-][N+]1(C)CCCC1c1cccnc1

Nicotine 1′-N-oxide is a chemical compound that plays a crucial role in various chemical synthesis processes. This versatile compound is widely utilized as a reagent in organic synthesis due to its unique properties and reactivity. In chemical synthesis, Nicotine 1′-N-oxide serves as a valuable intermediate for the preparation of various important organic compounds. Its ability to undergo selective reactions makes it a valuable tool for chemists in creating complex molecular structures. From constructing pharmaceutical intermediates to developing novel materials, Nicotine 1′-N-oxide offers a wide range of applications in the field of chemical synthesis.