
Catalog Number	AR00DJBQ
Chemical Name	1,4-anhydroxylitol
CAS Number	491-19-0
Molecular Formula	C5H10O4
Molecular Weight	134.1305
MDL Number	MFCD27923011
SMILES	OC[C@H]1OC[C@@H]([C@H]1O)O

1,4-Anhydroxylitol, also known as xylitol anhydride, is a versatile compound widely utilized in chemical synthesis. It serves as a useful building block in the production of various chemicals and materials. In organic chemistry, 1,4-Anhydroxylitol can undergo reactions to introduce functional groups or modify existing chemical structures. Its ability to react with different reagents makes it valuable in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, 1,4-Anhydroxylitol is used as a chiral starting material in asymmetric synthesis, enabling the creation of enantiomerically pure compounds with high stereochemical control. Its applications extend to polymer chemistry, where it can be incorporated into polymer chains to impart specific properties or functionalities. Overall, the versatility and reactivity of 1,4-Anhydroxylitol make it a key molecule in chemical synthesis with diverse applications across various industries.