
Catalog Number	AR006WN3
Chemical Name	Benzo[g]pteridine-2,4(1H,3H)-dione
CAS Number	490-59-5
Molecular Formula	C10H6N4O2
Molecular Weight	214.1802
MDL Number	MFCD00005020
SMILES	O=c1[nH]c2nc3ccccc3nc2c(=O)[nH]1

Alloxazine, a heterocyclic compound commonly used in chemical synthesis, plays a crucial role in various applications within the field of chemistry. Known for its versatility and unique structure, Alloxazine is often employed as a key building block in the creation of complex molecules and pharmaceuticals. With its ability to undergo various chemical transformations, Alloxazine serves as a valuable tool for organic chemists seeking to develop novel synthetic routes and achieve specific molecular structures. Additionally, its presence in numerous biochemical reactions underscores its significance in the study of enzyme mechanisms and metabolic pathways. In the realm of chemical synthesis, Alloxazine stands as a notable and indispensable component, enabling researchers to explore new realms of chemical reactivity and molecular design.