
Catalog Number	AR00DBSD
Chemical Name	(5R)-3-(3-FLUORO-4-IODOPHENYL)-5-HYDROXYMETHYLOXAZOLIDIN-2-ONE
CAS Number	487041-08-7
Molecular Formula	C10H9FINO3
Molecular Weight	337.0862
MDL Number	MFCD08166560
SMILES	OC[C@@H]1OC(=O)N(C1)c1ccc(c(c1)F)I

The compound (R)-3-(3-Fluoro-4-iodophenyl)-5-(hydroxymethyl)oxazolidin-2-one, referred to as $name$, serves as a versatile building block in chemical synthesis. With a unique combination of functional groups, $name$ is particularly valuable in the preparation of pharmaceutical intermediates and agrochemicals. Its oxazolidinone moiety provides a chiral center, allowing for the creation of enantioenriched compounds essential in drug development. Furthermore, the fluoro and iodo substituents offer opportunities for further derivatization through cross-coupling reactions. By incorporating $name$ into synthetic routes, chemists can access a diverse array of structurally complex molecules with potential biological activities.