
Catalog Number	AR00D8VV
Chemical Name	4-(4-MORPHOLINYLSULFONYL)PHENYLBORONIC ACID
CAS Number	486422-69-9
Molecular Formula	C14H24BN3O4S
Molecular Weight	341.2341
MDL Number	MFCD06659844
SMILES	OB(c1ccc(cc1)S(=O)(=O)NCCCN1CCN(CC1)C)O

Our product, (4-(N-(3-(4-Methylpiperazin-1-yl)propyl)sulfamoyl)phenyl)boronic acid, plays a crucial role in chemical synthesis as a versatile and valuable building block. Its unique structure containing boronic acid and sulfamoyl functionalities grants it the ability to participate in diverse synthetic transformations. One prominent application of this compound lies in its use as a key reagent in Suzuki-Miyaura cross-coupling reactions. By virtue of its boronic acid moiety, it can effectively engage in coupling reactions with various aryl halides or pseudohalides under mild conditions. This enables the formation of complex biaryl structures, which are ubiquitous in medicinal chemistry and material science.Additionally, the sulfamoyl group in the molecule can serve as a directing group in C-H activation reactions. Through selective functionalization of aromatic C-H bonds, this compound enables the synthesis of substituted benzene derivatives with high regioselectivity and efficiency. Such transformations are instrumental in streamlining synthetic pathways and accessing structurally intricate compounds.Overall, the (4-(N-(3-(4-Methylpiperazin-1-yl)propyl)sulfamoyl)phenyl)boronic acid presents itself as a valuable tool in the chemist's arsenal, facilitating the construction of diverse molecular architectures with precision and efficacy.