
Catalog Number	AR00DLV7
Chemical Name	4-(4-(tert-butoxycarbonyl)piperazin-1-ylsulfonyl)phenylboronic acid
CAS Number	486422-54-2
Molecular Formula	C15H23BN2O6S
Molecular Weight	370.2289
MDL Number	MFCD28384269
SMILES	OB(c1ccc(cc1)S(=O)(=O)N1CCN(CC1)C(=O)OC(C)(C)C)O

The 4-(4-(tert-butoxycarbonyl)piperazin-1-ylsulfonyl)phenylboronic acid is a versatile compound widely used in chemical synthesis as a key building block for various organic reactions. Its unique structure allows for the introduction of both boronic acid and sulfonamide functionalities, making it a valuable tool in medicinal chemistry, material science, and drug discovery.One of the primary applications of this compound is in Suzuki-Miyaura cross-coupling reactions, where it acts as a boronic acid coupling partner to form carbon-carbon bonds. This reaction is essential in the synthesis of biaryl compounds, which are prevalent in pharmaceuticals, agrochemicals, and natural products.Additionally, the sulfonamide group in the molecule serves as a directing group in transition metal-catalyzed C-H functionalization reactions. This property enables selective functionalization of aromatic rings, leading to the rapid construction of complex molecular structures with high efficiency.Overall, the 4-(4-(tert-butoxycarbonyl)piperazin-1-ylsulfonyl)phenylboronic acid offers a powerful platform for designing and synthesizing diverse organic molecules with applications ranging from drug development to material science.