
Catalog Number	AR00DZVL
Chemical Name	KOKUSAGININE
CAS Number	484-08-2
Molecular Formula	C14H13NO4
Molecular Weight	259.2573
MDL Number	MFCD01746564
SMILES	COc1cc2c(cc1OC)nc1c(c2OC)cco1

Kokusaginine is a naturally occurring alkaloid that plays a significant role in chemical synthesis. This compound is commonly used as a key building block in the creation of various pharmaceuticals and agrochemicals. Due to its unique structure and reactivity, Kokusaginine serves as a valuable starting material for the synthesis of complex organic molecules. Chemists frequently utilize Kokusaginine in versatile reactions such as cross-coupling, oxidation, and functional group transformations to construct intricate chemical structures with high efficiency and precision. Its versatile nature and synthetic utility make Kokusaginine a valuable tool in the modern synthetic chemist's toolkit.