
Catalog Number	AR01CCJU
Chemical Name	L-Phenylalanine,N-[[(3R)-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]-
CAS Number	4825-86-9
Molecular Formula	C20H19NO6
Molecular Weight	369.368
MDL Number	MFCD00133680
SMILES	C[C@@H]1OC(=O)c2c(C1)ccc(c2O)C(=O)N[C@H](C(=O)O)Cc1ccccc1
UN Number	3462

Ochratoxin B, a naturally occurring mycotoxin produced by certain fungi, has found application in chemical synthesis as a versatile starting material for the preparation of various compounds. With its unique chemical structure and reactivity, Ochratoxin B serves as a valuable building block for the synthesis of complex organic molecules and pharmaceutical intermediates. By exploiting its functional groups and stereochemistry, researchers can manipulate Ochratoxin B to introduce specific functionalities or structural motifs into target compounds. This enables the development of new synthetic pathways and strategies for accessing diverse chemical entities with potential applications in drug discovery, materials science, and other fields of research. By utilizing Ochratoxin B in chemical synthesis, scientists can harness its synthetic potential to create innovative and tailored molecules with desired properties and functions.