
Catalog Number	AR01EOKP
Chemical Name	Saccharin 1-methylimidazole
CAS Number	482333-74-4
Molecular Formula	C11H11N3O3S
Molecular Weight	265.2883
MDL Number	MFCD31657257
SMILES	O=C1NS(=O)(=O)c2c1cccc2.Cn1cncc1

Saccharin 1-methylimidazole (SMI) is a versatile compound commonly used in chemical synthesis as a catalyst for various reactions. Its unique structure and properties make it an excellent choice for promoting a wide range of organic transformations. In particular, SMI is known for its ability to catalyze reactions such as acylation, alkylation, and Suzuki-Miyaura coupling, among others. Additionally, SMI is highly efficient and selective, leading to enhanced yields and reduced unwanted byproducts in many synthetic processes. Its ease of use and stability under various reaction conditions further contribute to its popularity among chemists and researchers. Overall, SMI plays a crucial role in facilitating efficient and sustainable chemical synthesis strategies in both academic and industrial settings.