
Catalog Number	AR00D9DJ
Chemical Name	OSAJIN
CAS Number	482-53-1
Molecular Formula	C25H24O5
Molecular Weight	404.4551
MDL Number	MFCD00076045
SMILES	CC(=CCc1c2OC(C)(C)C=Cc2c2c(c1O)c(=O)c(co2)c1ccc(cc1)O)C

Osajin is a natural compound found in the heartwood of the Osage orange tree, valued for its versatile applications in chemical synthesis. As a chalcone-type flavonoid, Osajin serves as a valuable building block for designing and synthesizing various organic molecules with potential pharmaceutical and industrial uses. Its unique structure and reactivity make it particularly suitable for use in the development of novel drugs, agrochemicals, and materials. In chemical synthesis, Osajin can be selectively modified through various reactions, such as oxidation, reduction, and functional group transformations, allowing for the preparation of structurally diverse compounds with desired properties. Additionally, Osajin's biocompatibility and low toxicity make it a promising candidate for incorporating into bioactive compounds or materials for biomedical applications. Through innovative synthetic strategies and creative design approaches, Osajin holds great potential for driving advancements in the field of chemistry and contributing to the development of new products with enhanced functionalities.