
Catalog Number	AR01GE28
Chemical Name	2-Propanol,1,1'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis[3-chloro-
CAS Number	4809-35-2
Molecular Formula	C21H26Cl2O4
Molecular Weight	413.3347
MDL Number	MFCD01862947
SMILES	ClCC(COc1ccc(cc1)C(c1ccc(cc1)OCC(CCl)O)(C)C)O

The chemical compound 2-Propanol, 1,1'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis[3-chloro- is commonly utilized in chemical synthesis processes as a versatile reagent. It serves as a key intermediate in the production of various compounds due to its unique chemical properties. In synthetic chemistry, this compound is often employed as a solvent or a reactant for the creation of complex organic molecules. Its functional groups enable it to participate in a wide range of reactions, facilitating the formation of diverse chemical structures. The use of 2-Propanol, 1,1'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis[3-chloro- in chemical synthesis allows for the efficient and controlled construction of intricate molecular architectures, making it an indispensable component in the toolbox of organic chemists.