
Catalog Number	AR00I9G6
Chemical Name	1H-Indole-2-carboxylic acid, 5-chloro-4-fluoro-, methyl ester
CAS Number	480450-89-3
Molecular Formula	C10H7ClFNO2
Molecular Weight	227.6195
MDL Number	MFCD17926303
SMILES	COC(=O)c1cc2c([nH]1)ccc(c2F)Cl

Methyl 5-chloro-4-fluoro-1H-indole-2-carboxylate serves as a valuable building block in chemical synthesis, particularly in the development of novel organic compounds with diverse applications. This compound is utilized in the synthesis of pharmaceutical intermediates, agrochemicals, and functional materials due to its versatile reactivity and structural features. Its fluorine and chlorine substitution pattern confers unique properties that can be tailored to target specific biological or material properties. By incorporating Methyl 5-chloro-4-fluoro-1H-indole-2-carboxylate into synthetic pathways, researchers and chemists can access a wide range of structurally diverse molecules for various industries and research areas.