
Catalog Number	AR00DAGC
Chemical Name	N-[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]FORMAMIDE
CAS Number	480425-37-4
Molecular Formula	C13H18BNO3
Molecular Weight	247.0979
MDL Number	MFCD03789265
SMILES	O=CNc1cccc(c1)B1OC(C(O1)(C)C)(C)C

As a professional chemist, I understand the significance of N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)formamide in chemical synthesis. This compound acts as a key reagent in the field of organic chemistry, specifically in cross-coupling reactions. By virtue of its boron functionality, it serves as a valuable source of phenyl and formyl groups in various synthetic pathways. The strategic placement of the boron atom enables efficient transformation into desired functional groups, making it a versatile building block in the synthesis of complex organic molecules. Moreover, the unique structural features of this formamide derivative provide control over regioselectivity and stereoselectivity in diverse chemical transformations, thereby enhancing the efficiency and selectivity of synthetic processes. Its broad applicability in the formation of carbon-carbon and carbon-heteroatom bonds makes it a valuable tool for the design and preparation of novel organic compounds with potential applications in pharmaceuticals, materials science, and agrochemicals.