
Catalog Number	AR00DBUJ
Chemical Name	2-[(3-CHLOROPHENYL)METHOXY]-6-(1-PIPERAZINYL)PYRAZINE HYDROCHLORIDE
CAS Number	479683-64-2
Molecular Formula	C15H17ClN4O
Molecular Weight	304.7747
MDL Number	MFCD10687106
SMILES	Clc1cccc(c1)COc1cncc(n1)N1CCNCC1

2-[(3-Chlorophenyl)methoxy]-6-(1-piperazinyl)pyrazine is a versatile compound widely used in chemical synthesis for its unique properties and applications. In organic chemistry, it serves as a valuable building block for the synthesis of various pharmaceuticals and agrochemicals due to its functional groups and reactivity. This compound is particularly important in medicinal chemistry, where it can be utilized as a key intermediate in the development of anti-cancer, anti-inflammatory, or anti-microbial agents. Additionally, 2-[(3-Chlorophenyl)methoxy]-6-(1-piperazinyl)pyrazine plays a significant role in the discovery and optimization of novel drug candidates, making it an indispensable tool in the field of drug development. Its structural features make it amenable to diverse chemical transformations, allowing researchers to access a wide range of molecular scaffolds for further biological evaluation and drug design. Consequently, this compound is a cornerstone in the toolbox of synthetic chemists working towards the creation of new therapeutic agents with improved efficacy and safety profiles.