
Catalog Number	AR00DYUB
Chemical Name	1H-Pyrrolo[2,3-b]pyridine, 5-bromo-1-[(4-methylphenyl)sulfonyl]-
CAS Number	479552-71-1
Molecular Formula	C14H11BrN2O2S
Molecular Weight	351.2183
MDL Number	MFCD11616469
SMILES	Cc1ccc(cc1)S(=O)(=O)n1ccc2c1ncc(c2)Br

5-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine is a versatile compound commonly utilized in chemical synthesis as a key building block for the creation of novel organic molecules. With its unique structure and functional groups, this compound serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials.In organic synthesis, 5-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine plays a crucial role in forming complex molecular structures through various reactions such as cross-coupling, nucleophilic addition, and substitution reactions. Its bromine and sulfonyl groups provide excellent handle for further derivatization, allowing chemists to introduce specific functionalities and tailor the compound for desired properties.The presence of the pyrrolopyridine scaffold in this compound imparts unique reactivity and functionality, making it a valuable tool for designing and accessing diverse chemical structures. Whether used as a key structural element or as a reactive moiety, 5-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine offers chemists a powerful platform for exploring new synthetic routes and expanding the frontiers of chemical research and development.