
Catalog Number	AR01BJ2I
Chemical Name	2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine
CAS Number	280582-13-0
Molecular Formula	C10H6Cl2FN3
Molecular Weight	258.0791
MDL Number	MFCD23737482
SMILES	Fc1ccc(cc1)Nc1nc(Cl)ncc1Cl

The 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine is a versatile compound commonly utilized in chemical synthesis for the creation of novel pharmaceuticals and agrochemicals. Its unique molecular structure allows for targeted modifications and functionalization, making it a valuable building block in the production of various biologically active molecules. This compound serves as a key intermediate in the synthesis of potent antimicrobial agents, antiviral drugs, and herbicides. By incorporating 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine into organic reactions, chemists can access a diverse array of structurally diverse compounds with potential therapeutic and agricultural applications.