
Catalog Number	AR00OEWD
Chemical Name	1-TERT-BUTYL-4-METHANESULFONYLBENZENE
CAS Number	22796-14-1
Molecular Formula	C11H16O2S
Molecular Weight	212.3085
MDL Number	MFCD15527513
SMILES	CC(c1ccc(cc1)S(=O)(=O)C)(C)C

1-(1,1-Dimethylethyl)-4-(methylsulfonyl)benzene is a versatile compound commonly used in chemical synthesis as a building block for the creation of various organic compounds. Its unique structure makes it an important intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Due to its functional groups, this compound can participate in a variety of reactions such as aromatic substitutions, Friedel-Crafts reactions, and nucleophilic additions. In organic synthesis, it can serve as a key starting material for the development of new molecules with potential applications in a wide range of industries. Its presence in the synthesis process contributes to the creation of complex structures and plays a crucial role in the advancement of chemical research and development.