
Catalog Number	AR01FQIP
Chemical Name	N-cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
CAS Number	2267377-24-0
Molecular Formula	C17H26BNO2
Molecular Weight	287.2048
MDL Number	MFCD32206408
SMILES	CC1(C)OB(OC1(C)C)c1cccc(c1)NC1CCCC1

N-Cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is a vital component in modern chemical synthesis processes. This compound plays a crucial role as a versatile building block due to its unique structural features. Its application in chemical synthesis lies in its ability to serve as a key intermediate for the preparation of various functionalized molecules. Specifically, this compound is frequently utilized in Suzuki-Miyaura cross-coupling reactions, where it acts as a valuable boronic acid derivative for the formation of C-C bonds. Additionally, its cyclopentyl moiety provides steric hindrance, influencing the regioselectivity and overall efficiency of the desired synthetic transformations. With its strategic placement of functional groups, N-Cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline emerges as a powerful tool in the hands of synthetic chemists for the construction of complex molecular architectures.

Pyridine, 2-fluoro-6-(tributylstannyl)-

1025744-38-0

$10.00/100mg, $14.00/250mg, $15.00/500mg, $29.00/1g, $116.00/5g,

Product Details

Pyridine, 3-bromo-2,6-bis(phenylmethoxy)-

16727-47-2

$3.00/100mg, $3.00/250mg, $4.00/1g, $10.00/5g, $16.00/10g, $21.00/25g, $61.00/100g, $122.00/250g, $225.00/500g, $433.00/1kg, $2,077.00/5kg, $3,808.00/10kg,

Product Details