
Catalog Number	AR01FQ1G
Chemical Name	4-Morpholinecarboxamide, N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
CAS Number	2246774-05-8
Molecular Formula	C18H27BN2O4
Molecular Weight	346.229
MDL Number	MFCD32206549
SMILES	O=C(N1CCOCC1)Nc1ccc(cc1C)B1OC(C(O1)(C)C)(C)C

The compound N-(2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)morpholine-4-carboxamide, also known as $name$, is widely utilized in chemical synthesis as a key reagent due to its unique structural properties. This compound plays a crucial role in various organic reactions, particularly in the formation of C-N bonds and the introduction of functional groups in complex molecule synthesis. Additionally, $name$ acts as an efficient catalyst in cross-coupling reactions, facilitating the creation of diverse molecular structures with high precision and selectivity. Its versatile nature and reliable performance make it an indispensable tool for chemists working in the field of organic synthesis, enabling the development of novel compounds and materials with significant potential in pharmaceuticals, materials science, and other industrial applications.