
Catalog Number	AR01FSXV
Chemical Name	4-Chloro-N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide
CAS Number	2246586-62-7
Molecular Formula	C19H21BClNO3
Molecular Weight	357.6389
MDL Number	MFCD32661446
SMILES	Clc1ccc(cc1)C(=O)Nc1cccc(c1)B1OC(C(O1)(C)C)(C)C

4-Chloro-N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide is a valuable compound widely utilized in chemical synthesis processes. This compound serves as a key building block in the creation of intricate organic molecules and pharmaceutical intermediates. Its specific chemical structure enables it to participate in numerous reactions, facilitating the synthesis of various complex compounds with enhanced biological activities. Additionally, its unique properties make it a versatile tool for designing and constructing novel molecular structures with desired functionalities. endforeach