
Catalog Number	AR020MWN
Chemical Name	(R)-3-(4-(2-Chloro-5-iodobenzyl)phenoxy)tetrahydrofuran
CAS Number	2194590-02-6
Molecular Formula	C17H16ClIO2
Molecular Weight	414.6652
SMILES	Ic1ccc(c(c1)Cc1ccc(cc1)O[C@H]1COCC1)Cl

The compound (R)-3-(4-(2-Chloro-5-iodobenzyl)phenoxy)tetrahydrofuran, also known as $name$, plays a crucial role in chemical synthesis, particularly in the field of medicinal chemistry. Its unique structure and properties make it a versatile intermediate for the synthesis of various pharmaceutical compounds with potential therapeutic applications. By serving as a key building block in the creation of biologically active molecules, $name$ enables researchers to explore new avenues in drug discovery and development. With its carefully designed molecular architecture, this compound facilitates the formation of complex molecular structures, essential for the production of novel drugs with improved efficacy and selectivity. In the realm of chemical synthesis, (R)-3-(4-(2-Chloro-5-iodobenzyl)phenoxy)tetrahydrofuran stands as a valuable tool for advancing the frontiers of modern medicine.