
Catalog Number	AR01K6DN
Chemical Name	Amino-PEG24-t-butylester
CAS Number	2170987-96-7
Molecular Formula	C55H111NO26
Molecular Weight	1202.4609
MDL Number	MFCD11041158
SMILES	NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C

Amino-PEG25-t-butyl ester is a versatile compound widely used in chemical synthesis as a crucial building block for the modification of various molecules. Its primary application lies in providing a stable and biocompatible linker that can be easily incorporated into diverse biomolecules and nanostructures. With a t-butyl ester protecting group, this compound offers enhanced stability and solubility, making it ideal for use in peptide and protein chemistry. Additionally, the polyethylene glycol (PEG) spacer imparts flexibility and hydrophilicity, facilitating conjugation reactions and enhancing the overall biocompatibility of the modified molecules. In organic synthesis, Amino-PEG25-t-butyl ester serves as a valuable tool for introducing functionality, enabling the creation of novel compounds with tailored properties for a wide range of applications in drug delivery, diagnostics, and materials science.