
Catalog Number	AR01FT68
Chemical Name	TERT-BUTYL 5-FLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDOLE-1-CARBOXYLATE
CAS Number	2095464-28-9
Molecular Formula	C19H25BFNO4
Molecular Weight	361.2155
MDL Number	MFCD30829985
SMILES	Fc1ccc2c(c1)c(cn2C(=O)OC(C)(C)C)B1OC(C(O1)(C)C)(C)C

The TERT-BUTYL 5-FLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDOLE-1-CARBOXYLATE molecule plays a crucial role in chemical synthesis as a versatile building block. Its unique structure containing a fluorine atom and a boron-containing moiety makes it a valuable intermediate in the synthesis of complex organic compounds. This compound can be utilized in the preparation of various pharmaceuticals, agrochemicals, and materials due to its reactivity and functionality. In synthesis, it serves as a key component for introducing fluorine and boron functionalities into target molecules, enabling chemists to access a diverse range of compounds with desired properties.