
Catalog Number	AR007RE9
Chemical Name	Phenol,2-(1,1-dimethylethyl)-6-methyl-4-[3-[[2,4,8,10-tetrakis(1,1-dimethylethyl)dibenzo[d,f][1,3,2]dioxaphosphepin-6-yl]oxy]propyl]-
CAS Number	203255-81-6
Molecular Formula	C42H73O4P
Molecular Weight	673.0004
MDL Number	MFCD22495371
SMILES	Cc1cc(CCCOP2OC3C(C4C(O2)C(CC(C4)C(C)(C)C)C(C)(C)C)CC(CC3C(C)(C)C)C(C)(C)C)cc(c1O)C(C)(C)C

2-(1,1-Dimethylethyl)-6-methyl-4-[3-[[2,4,8,10-tetrakis(1,1-dimethylethyl)dibenzo[d,f][1,3,2]dioxaphosphepin-6-yl]oxy]propyl]phenol is a versatile compound used in chemical synthesis as a potent antioxidant and stabilizer. It is commonly employed in the synthesis of polymers, plastics, and pharmaceuticals to enhance their durability and performance. This compound serves as a crucial ingredient in the development of advanced materials with improved resistance to degradation and oxidation. Its unique chemical structure allows for efficient incorporation into various products, contributing to the overall quality and longevity of the final materials.