
Catalog Number	AR00APN0
Chemical Name	Dicyclohexano-24-crown-8
CAS Number	17455-23-1
Molecular Formula	C24H44O8
Molecular Weight	460.6014
MDL Number	MFCD00005102
SMILES	C1COCCOC2CCCCC2OCCOCCOCCOC2C(OCCO1)CCCC2

As a professional chemist, I can confidently state that Dicyclohexano-24-crown-8, commonly referred to as DC24C8, plays a crucial role in chemical synthesis as a versatile crown ether. With its unique cyclic structure and crown-like shape, DC24C8 has the ability to selectively bind cations, particularly alkali and alkaline earth metals, leading to the formation of stable coordination complexes.In chemical synthesis, DC24C8 is often used as a phase-transfer catalyst, facilitating the transfer of cations between different phases. This property makes it a valuable tool in organic reactions that involve multiple phases, such as liquid-liquid or solid-liquid reactions. Additionally, DC24C8 can serve as a chelating agent, selectively capturing metal ions and influencing the course of chemical reactions.Furthermore, DC24C8's ability to form stable complexes with metal cations enhances the selectivity and efficiency of various chemical transformations. Its use in catalysis, coordination chemistry, and supramolecular chemistry highlights its significance in advancing synthetic methodologies and promoting the development of novel compounds with tailored properties.