
Catalog Number	AR001ZPL
Chemical Name	Benzoic acid, 3,5-bis(4-nitrophenoxy)-
CAS Number	173550-33-9
Molecular Formula	C19H12N2O8
Molecular Weight	396.3072
MDL Number	MFCD02093450
SMILES	OC(=O)c1cc(cc(c1)Oc1ccc(cc1)[N+](=O)[O-])Oc1ccc(cc1)[N+](=O)[O-]

3,5-Bis(4-Nitrophenoxy)Benzoic Acid, also known as $name$, is a versatile compound frequently utilized in chemical synthesis processes. This compound is valued for its ability to serve as a crucial building block in the creation of various advanced materials and specialized organic molecules. In chemical synthesis, $name$ plays a key role as a core component in the development of novel pharmaceuticals, agrochemicals, and materials used in industries such as electronics and polymers. Its unique molecular structure enables it to participate in diverse reactions, leading to the formation of complex compounds with tailored properties and functionalities. By incorporating $name$ into synthetic routes, chemists can achieve a greater degree of control over the final product's structure, purity, and performance characteristics.

Benzoic acid, 3,5-bis(4-nitrophenoxy)-

173550-33-9

Product Details