
Catalog Number	AR00AS9D
Chemical Name	2-(4-Methylpiperidin-1-yl)-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide
CAS Number	1704120-84-2
Molecular Formula	C20H31BN2O3
Molecular Weight	358.2827399999998
MDL Number	MFCD28805652
SMILES	CC1CCN(CC1)CC(=O)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

The compound 2-(4-Methylpiperidin-1-yl)-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide is commonly used in chemical synthesis as a versatile building block for the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound serves as a key intermediate in the synthesis of complex organic molecules due to its unique structural properties and functional groups. Its strategic placement of a boron-containing moiety enables facile derivatization, allowing for the introduction of diverse functional groups. By incorporating this compound into synthetic routes, chemists can access a wide array of structurally diverse compounds with potential applications in medicinal chemistry, materials science, and other fields requiring the design and production of novel molecules.