
Catalog Number	AR00AS2H
Chemical Name	(4-(N-cyclopentylsulfaMoyl)-3,5-diMethylphenyl)boronic acid
CAS Number	1704097-46-0
Molecular Formula	C13H20BNO4S
Molecular Weight	297.1782
MDL Number	MFCD28805602
SMILES	OB(c1cc(C)c(c(c1)C)S(=O)(=O)NC1CCCC1)O

The (4-(N-cyclopentylsulfaMoyl)-3,5-diMethylphenyl)boronic acid is a versatile compound widely used in chemical synthesis as a valuable building block. This boronic acid derivative serves as a crucial reagent in Suzuki-Miyaura cross-coupling reactions, allowing for the formation of carbon-carbon bonds. Its unique structure containing a boronic acid group enables it to participate in various coupling reactions with aryl halides, offering a powerful tool for the creation of complex organic molecules. Additionally, this compound has found applications in pharmaceutical chemistry, material science, and agrochemical research due to its compatibility with a wide range of functional groups and its ability to enable efficient construction of target molecules.