
Catalog Number	AR00AS06
Chemical Name	(3-Fluoro-5-(4-methylpiperazin-1-yl)phenyl)boronic acid
CAS Number	1704073-49-3
Molecular Formula	C11H16BFN2O2
Molecular Weight	238.06634320000006
MDL Number	MFCD24448996
SMILES	CN1CCN(CC1)c1cc(F)cc(c1)B(O)O

Boronic acid, B-[3-fluoro-5-(4-methyl-1-piperazinyl)phenyl]-, is a versatile compound widely used in chemical synthesis. This particular boronic acid derivative plays a crucial role in organic chemistry as a key building block for the creation of various pharmaceuticals, agrochemicals, and materials. Its ability to form stable complexes with a wide range of organic molecules makes it highly valuable in designing new drug candidates and conducting medicinal chemistry research. Additionally, this compound's unique structural features enable it to participate in diverse reactions such as Suzuki-Miyaura cross-coupling, C-H activation, and α-arylation, leading to the efficient synthesis of complex molecules with potential applications in the fields of medicine and materials science.