
Catalog Number	AR00AS1C
Chemical Name	(4-(1-(4-Methylpiperazin-1-yl)ethyl)phenyl)boronic acid hydrochloride
CAS Number	1704069-16-8
Molecular Formula	C13H22BClN2O2
Molecular Weight	284.59
MDL Number	MFCD28384341
SMILES	OB(c1ccc(cc1)C(N1CCN(CC1)C)C)O.Cl

The (4-(1-(4-methylpiperazin-1-yl)ethyl)phenyl)boronic acid hydrochloride is a versatile reagent used in chemical synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. It serves as a key building block for the synthesis of various biologically active molecules, pharmaceuticals, and materials. With its boronic acid functionality, this compound has shown significant utility in Suzuki-Miyaura cross-coupling reactions, allowing for the introduction of aryl and heteroaryl groups into target molecules. Additionally, its hydrochloride form enhances the solubility and stability of the compound, making it easier to handle in reactions. By incorporating this compound into synthetic routes, chemists can access a wide range of structurally diverse compounds for drug discovery, materials science, and other chemical applications.