
Catalog Number	AR00ASJX
Chemical Name	1-Boc-4-(4-nitrophenyl)Piperidine
CAS Number	170011-56-0
Molecular Formula	C16H22N2O4
Molecular Weight	306.35688000000005
MDL Number	MFCD11111402
SMILES	O=C(N1CCC(CC1)c1ccc(cc1)[N+](=O)[O-])OC(C)(C)C

1-Boc-4-(4-nitrophenyl)piperidine is a versatile compound that finds wide application in chemical synthesis, specifically in the field of organic chemistry. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. The Boc (tert-butoxycarbonyl) protecting group attached to the piperidine nitrogen atom in this molecule offers selective reactivity and allows for controlled manipulation of the compound in various chemical reactions. This feature makes 1-Boc-4-(4-nitrophenyl)piperidine a valuable intermediate in the production of complex organic molecules. Its ability to act as a masked amine group enables it to participate in a range of synthetic transformations, including amidation, reductive amination, and nucleophilic substitution reactions. By incorporating this compound into synthetic routes, chemists can access structurally diverse compounds with tailored properties, making it a crucial component in the development of novel chemical entities.