
Catalog Number	AR001Z5X
Chemical Name	Ethanaminium, N,N,N-triethyl-, benzoate (1:1)
CAS Number	16909-22-1
Molecular Formula	C15H25NO2
Molecular Weight	251.3645
MDL Number	MFCD00041976
SMILES	[O-]C(=O)c1ccccc1.CC[N+](CC)(CC)CC

$Name$ is a versatile chemical compound that finds numerous applications in chemical synthesis, particularly in organic chemistry. One of its key uses is as a phase-transfer catalyst in various reactions. Due to its unique properties, Tetraethylammonium benzoate is able to facilitate the transfer of reactants between different phases, thereby enhancing reaction rates and yields. This compound is especially valuable in reactions that involve immiscible solvents or reagents, where it helps to bring together the reactants and promote efficient interaction. Additionally, Tetraethylammonium benzoate can also serve as a quaternary ammonium salt source in various organic transformations, providing a convenient and effective means to introduce this functional group into target molecules. Its ability to act as both a phase-transfer catalyst and a quaternary ammonium salt precursor makes Tetraethylammonium benzoate a valuable tool for chemists engaged in the synthesis of complex organic compounds.