
Catalog Number	AR00ASA4
Chemical Name	2-Morpholino-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide
CAS Number	1628017-79-7
Molecular Formula	C18H27BN2O4
Molecular Weight	346.229
MDL Number	MFCD28400533
SMILES	O=C(Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C)CN1CCOCC1

N-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-morpholineacetamide is a versatile compound widely utilized in chemical synthesis as a key intermediate for the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound serves as a crucial building block in the development of advanced materials and organic compounds due to its unique structural properties. In chemical synthesis, N-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-morpholineacetamide plays a pivotal role as a functional group transfer reagent, enabling the selective introduction of specific chemical functionalities into target molecules. Its reactivity and compatibility with a wide range of reaction conditions make it a valuable tool for the efficient construction of complex organic structures with high precision and control.