
Catalog Number	AR02ET9F
Chemical Name	5-Bromo-2-(quinolin-6-yl)benzo[d]oxazole
CAS Number	1616593-18-0
Molecular Formula	C16H9BrN2O
Molecular Weight	325.1595
SMILES	Brc1ccc2c(c1)nc(o2)c1ccc2c(c1)cccn2

5-Bromo-2-(quinolin-6-yl)benzo[d]oxazole serves as a versatile building block in chemical synthesis, particularly in the field of medicinal chemistry. This compound demonstrates potent pharmacological activities due to its unique molecular structure, making it a valuable tool in the development of new pharmaceutical agents. Its ability to undergo various chemical transformations allows for the synthesis of diverse derivatives with potential biological activities. With its distinctive quinoline and benzooxazole moieties, this compound offers novel opportunities for the creation of drug candidates targeting specific biological pathways. Its application in chemical synthesis paves the way for the discovery of innovative therapeutic agents with enhanced potency and selectivity.