
Catalog Number	AR01DUF1
Chemical Name	1-(ethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS Number	1612173-68-8
Molecular Formula	C11H19BN2O4S
Molecular Weight	286.1556
MDL Number	MFCD29763679
SMILES	CCS(=O)(=O)n1ncc(c1)B1OC(C(O1)(C)C)(C)C

1-(ethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a versatile compound used in chemical synthesis for C-C bond formation and functional group manipulation. This compound serves as a key building block in the construction of complex molecular structures through Suzuki-Miyaura cross-coupling reactions. Additionally, its unique structural properties make it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials science applications. Its utility in organic synthesis lies in its ability to introduce sulfonyl and boron functionalities into target molecules with high efficiency and selectivity. By incorporating 1-(ethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole into synthetic pathways, chemists can access a wide range of novel compounds with diverse chemical and biological properties.