
Catalog Number	AR01FOHU
Chemical Name	N-cyclopropyl-2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetamide
CAS Number	1595290-69-9
Molecular Formula	C17H24BNO4
Molecular Weight	317.1878
MDL Number	MFCD32206493
SMILES	O=C(NC1CC1)COc1cccc(c1)B1OC(C(O1)(C)C)(C)C

The N-Cyclopropyl-2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetamide compound plays a crucial role in chemical synthesis as a versatile building block. Its unique structure provides a platform for the introduction of various functional groups, making it valuable in the creation of complex organic molecules. This compound is particularly useful in the development of pharmaceuticals, agrochemicals, and advanced materials. By serving as a key component in the synthesis process, N-Cyclopropyl-2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetamide enables chemists to efficiently access diverse molecular structures with specific desired properties.