
Catalog Number	AR01KGYV
Chemical Name	tert-butyl 2-fluorobenzylcarbamate
CAS Number	153903-21-0
Molecular Formula	C12H16FNO2
Molecular Weight	225.2593
MDL Number	MFCD21105802
SMILES	O=C(OC(C)(C)C)NCc1ccccc1F

Tert-butyl 2-fluorobenzylcarbamate is a versatile compound that finds widespread application in chemical synthesis. This compound serves as a crucial building block in the production of various pharmaceuticals and agrochemicals due to its unique chemical properties. In organic synthesis, tert-butyl 2-fluorobenzylcarbamate can be utilized as a protecting group for amines, enabling selective reactions to occur without interfering with other functional groups present in the molecule. Additionally, it can act as a precursor for the introduction of the fluorine atom into complex organic structures, a valuable modification for enhancing the biological activity of certain compounds. Its use in medicinal chemistry is particularly noteworthy, as the incorporation of the tert-butyl 2-fluorobenzylcarbamate moiety into drug candidates can improve their metabolic stability and pharmacokinetic profile. With its versatility and importance in chemical synthesis, tert-butyl 2-fluorobenzylcarbamate continues to be a valuable tool for researchers and chemists working in various fields of science and technology.