
Catalog Number	AR001JEN
Chemical Name	Benzene, 1-bromo-2,5-difluoro-4-(trifluoromethoxy)-
CAS Number	1439904-14-9
Molecular Formula	C7H2BrF5O
Molecular Weight	276.9862
MDL Number	MFCD25458130
SMILES	Fc1cc(Br)c(cc1OC(F)(F)F)F

1-Bromo-2,5-difluoro-4-(trifluoromethoxy)benzene serves as a valuable building block in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and materials science. With its unique combination of halogen and fluorine substituents, this compound offers a versatile platform for the creation of novel chemical structures with enhanced properties. In chemical synthesis, it can be used as a key intermediate in the preparation of complex molecules through various transformations such as nucleophilic substitution, palladium-catalyzed cross-coupling reactions, and metal-halogen exchange reactions. Its strategic placement of functional groups enables facile diversification and modification, making it a valuable tool for the synthesis of diverse bioactive molecules and advanced materials.