
Catalog Number	AR00HXHA
Chemical Name	N-cyclopentyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
CAS Number	1430474-31-9
Molecular Formula	C17H26BNO2
Molecular Weight	287.2048
MDL Number	MFCD26383468
SMILES	CC1(C)OB(OC1(C)C)c1ccc(cc1)NC1CCCC1

N-Cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is a versatile compound that finds wide application in organic synthesis, particularly in the field of medicinal and materials chemistry. This specialized reagent serves as a key building block in the preparation of various functionalized molecules through Suzuki-Miyaura cross-coupling reactions. By acting as a boronic acid precursor, this compound enables the introduction of the aniline moiety into target molecules, facilitating the synthesis of diverse organic compounds with tailored properties. Its unique structure, combining a cyclopentyl group with a boronic ester and an aniline functionality, imparts specific reactivity that allows for the construction of complex structures with high efficiency. In chemical synthesis, N-Cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline serves as a valuable tool for researchers and chemists seeking to access novel materials and bioactive compounds for various applications.