
Catalog Number	AR01FQJL
Chemical Name	N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
CAS Number	1430474-30-8
Molecular Formula	C18H28BNO2
Molecular Weight	301.2314
MDL Number	MFCD32206407
SMILES	CC1(C)OB(OC1(C)C)c1ccc(cc1)NC1CCCCC1

N-Cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is a powerful tool in chemical synthesis due to its unique properties and versatile reactivity. This compound serves as a key building block in the preparation of various organic molecules through Suzuki coupling reactions. By acting as a boronic acid derivative, it readily participates in cross-coupling reactions with aryl halides or vinyl halides, facilitating the formation of carbon-carbon bonds in a controlled and efficient manner. This process enables the synthesis of complex organic compounds with high yields and selectivity, making N-Cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline an indispensable component in the toolkit of synthetic chemists.