
Catalog Number	AR01DV1R
Chemical Name	tert-Butyl 4-(2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetyl)piperazine-1-carboxylate
CAS Number	1401697-54-8
Molecular Formula	C23H35BN2O6
Molecular Weight	446.3448
MDL Number	MFCD31916429
SMILES	O=C(N1CCN(CC1)C(=O)OC(C)(C)C)COc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

The tert-Butyl 4-(2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetyl)piperazine-1-carboxylate is a versatile compound used in chemical synthesis for its ability to act as a protecting group for sensitive functional groups. This compound is commonly employed in organic chemistry reactions to temporarily shield reactive sites on molecules, thereby preventing undesired side reactions or interactions during various transformations. In particular, the tert-Butyl 4-(2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetyl)piperazine-1-carboxylate can safeguard specific functional groups from unwanted modifications or reactivity, allowing chemists to achieve selective and controlled modifications in complex synthesis pathways. Its selectivity and compatibility make it a valuable tool in the design and execution of intricate chemical reactions, enabling the synthesis of novel compounds with precision and efficiency.