
Catalog Number	AR01DEF2
Chemical Name	METHYL 2-((1S)-1-AMINOETHYL)BENZOATE HYDROCHLORIDE
CAS Number	1391483-59-2
Molecular Formula	C10H14ClNO2
Molecular Weight	215.6767
MDL Number	MFCD12910777
SMILES	COC(=O)c1ccccc1[C@@H](N)C.Cl

Methyl (S)-2-(1-aminoethyl)benzoate hydrochloride, also known as $name$, is a versatile compound widely used in chemical synthesis. Its application primarily lies in the field of organic chemistry, where it serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals.$name$ plays a crucial role as a chiral intermediate in the synthesis of biologically active molecules and pharmaceuticals due to its enantiopure nature. The presence of the aminoethyl group provides a valuable handle for further functionalization, allowing for the introduction of diverse chemical functionalities to tailor the properties of the final product.In chemical synthesis, $name$ can be utilized in asymmetric catalysis, stereoselective transformations, and the construction of complex molecular scaffolds. Its unique structural characteristics make it suitable for the synthesis of drug candidates, natural products, and specialty chemicals with high levels of stereocontrol and efficiency.Furthermore, $name$ is a valuable tool for research purposes, enabling chemists to explore new reaction pathways, develop innovative synthetic strategies, and enhance the overall efficiency of organic transformations. Its versatility and compatibility with a wide range of synthetic methodologies make it a sought-after compound in the field of chemical synthesis.